C29H38N3O7P — CID 56969761
N-[dibutoxyphosphoryl-(4-methylphenyl)methyl]-2-(4,6-dimethoxypyrimidin-2-yl)oxybenzamide (PubChem CID 56969761) has the molecular formula C29H38N3O7P and a molecular weight of 571.61 g/mol. Its IUPAC name is N-[dibutoxyphosphoryl-(4-methylphenyl)methyl]-2-(4,6-dimethoxypyrimidin-2-yl)oxybenzamide.
| Compound Name | N-[dibutoxyphosphoryl-(4-methylphenyl)methyl]-2-(4,6-dimethoxypyrimidin-2-yl)oxybenzamide |
|---|---|
| PubChem CID | 56969761 |
| Molecular Formula | C29H38N3O7P |
| Molecular Weight | 571.61 g/mol |
| Exact Mass | 571.24 |
| IUPAC Name | N-[dibutoxyphosphoryl-(4-methylphenyl)methyl]-2-(4,6-dimethoxypyrimidin-2-yl)oxybenzamide |
| SMILES | CCCCOP(=O)(OCCCC)C(NC(=O)c1ccccc1Oc1nc(OC)cc(OC)n1)c1ccc(C)cc1 |
| InChI | InChI=1S/C29H38N3O7P/c1-6-8-18-37-40(34,38-19-9-7-2)28(22-16-14-21(3)15-17-22)32-27(33)23-12-10-11-13-24(23)39-29-30-25(35-4)20-26(31-29)36-5/h10-17,20,28H,6-9,18-19H2,1-5H3,(H,32,33) |
| InChIKey | QOGMBKGTNWVYTG-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 118.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.61 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|