C19H17ClN4O4 — CID 4152975
N'-(4-chlorophenyl)-2-(4,6-dimethoxypyrimidin-2-yl)oxybenzohydrazide (PubChem CID 4152975) has the molecular formula C19H17ClN4O4 and a molecular weight of 400.82 g/mol. Its IUPAC name is N'-(4-chlorophenyl)-2-(4,6-dimethoxypyrimidin-2-yl)oxybenzohydrazide.
| Compound Name | N'-(4-chlorophenyl)-2-(4,6-dimethoxypyrimidin-2-yl)oxybenzohydrazide |
|---|---|
| PubChem CID | 4152975 |
| Molecular Formula | C19H17ClN4O4 |
| Molecular Weight | 400.82 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | N'-(4-chlorophenyl)-2-(4,6-dimethoxypyrimidin-2-yl)oxybenzohydrazide |
| SMILES | COc1cc(OC)nc(Oc2ccccc2C(=O)NNc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C19H17ClN4O4/c1-26-16-11-17(27-2)22-19(21-16)28-15-6-4-3-5-14(15)18(25)24-23-13-9-7-12(20)8-10-13/h3-11,23H,1-2H3,(H,24,25) |
| InChIKey | FZSULSJVFOSFIW-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 94.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.82 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|