About diethyl 2-[[2-(4,6-dimethoxypyrimidin-2-yl)oxybenzoyl]amino]pentanedioate
diethyl 2-[[2-(4,6-dimethoxypyrimidin-2-yl)oxybenzoyl]amino]pentanedioate (PubChem CID 3576006) has the molecular formula C22H27N3O8
and a molecular weight of 461.47 g/mol. Its IUPAC name is diethyl 2-[[2-(4,6-dimethoxypyrimidin-2-yl)oxybenzoyl]amino]pentanedioate.
Molecular Properties
| Compound Name | diethyl 2-[[2-(4,6-dimethoxypyrimidin-2-yl)oxybenzoyl]amino]pentanedioate |
| PubChem CID | 3576006 |
| Molecular Formula | C22H27N3O8 |
| Molecular Weight | 461.47 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | diethyl 2-[[2-(4,6-dimethoxypyrimidin-2-yl)oxybenzoyl]amino]pentanedioate |
| SMILES | CCOC(=O)CCC(NC(=O)c1ccccc1Oc1nc(OC)cc(OC)n1)C(=O)OCC |
| InChI | InChI=1S/C22H27N3O8/c1-5-31-19(26)12-11-15(21(28)32-6-2)23-20(27)14-9-7-8-10-16(14)33-22-24-17(29-3)13-18(25-22)30-4/h7-10,13,15H,5-6,11-12H2,1-4H3,(H,23,27) |
| InChIKey | TXSMQHOEKNAYOW-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 135.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 461.47 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Analyze diethyl 2-[[2-(4,6-dimethoxypyrimidin-2-yl)oxybenzoyl]amino]pentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 2-[[2-(4,6-dimethoxypyrimidin-2-yl)oxybenzoyl]amino]pentanedioate?
The IUPAC name of diethyl 2-[[2-(4,6-dimethoxypyrimidin-2-yl)oxybenzoyl]amino]pentanedioate (CID 3576006) is diethyl 2-[[2-(4,6-dimethoxypyrimidin-2-yl)oxybenzoyl]amino]pentanedioate.
What is the SMILES notation for diethyl 2-[[2-(4,6-dimethoxypyrimidin-2-yl)oxybenzoyl]amino]pentanedioate?
The canonical SMILES for diethyl 2-[[2-(4,6-dimethoxypyrimidin-2-yl)oxybenzoyl]amino]pentanedioate is CCOC(=O)CCC(NC(=O)c1ccccc1Oc1nc(OC)cc(OC)n1)C(=O)OCC.
What is the InChIKey of diethyl 2-[[2-(4,6-dimethoxypyrimidin-2-yl)oxybenzoyl]amino]pentanedioate?
The InChIKey is TXSMQHOEKNAYOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27N3O8/c1-5-31-19(26)12-11-15(21(28)32-6-2)23-20(27)14-9-7-8-10-16(14)33-22-24-17(29-3)13-18(25-22)30-4/h7-10,13,15H,5-6,11-12H2,1-4H3,(H,23,27).
What are the key properties of diethyl 2-[[2-(4,6-dimethoxypyrimidin-2-yl)oxybenzoyl]amino]pentanedioate?
diethyl 2-[[2-(4,6-dimethoxypyrimidin-2-yl)oxybenzoyl]amino]pentanedioate has a molecular weight of 461.47 g/mol, XLogP of 2.29, 12 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2-[[2-(4,6-dimethoxypyrimidin-2-yl)oxybenzoyl]amino]pentanedioate is sourced from PubChem (CID 3576006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).