C20H26N2O6 — CID 14730681
diethyl (2S)-2-[[2-methoxy-4-(prop-2-ynylamino)benzoyl]amino]pentanedioate (PubChem CID 14730681) has the molecular formula C20H26N2O6 and a molecular weight of 390.44 g/mol. Its IUPAC name is diethyl (2S)-2-[[2-methoxy-4-(prop-2-ynylamino)benzoyl]amino]pentanedioate.
| Compound Name | diethyl (2S)-2-[[2-methoxy-4-(prop-2-ynylamino)benzoyl]amino]pentanedioate |
|---|---|
| PubChem CID | 14730681 |
| Molecular Formula | C20H26N2O6 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | diethyl (2S)-2-[[2-methoxy-4-(prop-2-ynylamino)benzoyl]amino]pentanedioate |
| SMILES | C#CCNc1ccc(C(=O)N[C@@H](CCC(=O)OCC)C(=O)OCC)c(OC)c1 |
| InChI | InChI=1S/C20H26N2O6/c1-5-12-21-14-8-9-15(17(13-14)26-4)19(24)22-16(20(25)28-7-3)10-11-18(23)27-6-2/h1,8-9,13,16,21H,6-7,10-12H2,2-4H3,(H,22,24)/t16-/m0/s1 |
| InChIKey | LOROQQZRYWRLKO-INIZCTEOSA-N |
| XLogP | 1.75 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|