C18H22N2O5 — CID 101480653
diethyl (2S)-2-[(4-ethynylphenyl)carbamoylamino]pentanedioate (PubChem CID 101480653) has the molecular formula C18H22N2O5 and a molecular weight of 346.38 g/mol. Its IUPAC name is diethyl (2S)-2-[(4-ethynylphenyl)carbamoylamino]pentanedioate.
| Compound Name | diethyl (2S)-2-[(4-ethynylphenyl)carbamoylamino]pentanedioate |
|---|---|
| PubChem CID | 101480653 |
| Molecular Formula | C18H22N2O5 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | diethyl (2S)-2-[(4-ethynylphenyl)carbamoylamino]pentanedioate |
| SMILES | C#Cc1ccc(NC(=O)N[C@@H](CCC(=O)OCC)C(=O)OCC)cc1 |
| InChI | InChI=1S/C18H22N2O5/c1-4-13-7-9-14(10-8-13)19-18(23)20-15(17(22)25-6-3)11-12-16(21)24-5-2/h1,7-10,15H,5-6,11-12H2,2-3H3,(H2,19,20,23)/t15-/m0/s1 |
| InChIKey | GGEMFBCMHUOLGO-HNNXBMFYSA-N |
| XLogP | 2.06 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|