C17H20N2O5 — CID 101480654
diethyl (2S)-2-[(4-ethynylphenyl)carbamoylamino]butanedioate (PubChem CID 101480654) has the molecular formula C17H20N2O5 and a molecular weight of 332.36 g/mol. Its IUPAC name is diethyl (2S)-2-[(4-ethynylphenyl)carbamoylamino]butanedioate.
| Compound Name | diethyl (2S)-2-[(4-ethynylphenyl)carbamoylamino]butanedioate |
|---|---|
| PubChem CID | 101480654 |
| Molecular Formula | C17H20N2O5 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | diethyl (2S)-2-[(4-ethynylphenyl)carbamoylamino]butanedioate |
| SMILES | C#Cc1ccc(NC(=O)N[C@@H](CC(=O)OCC)C(=O)OCC)cc1 |
| InChI | InChI=1S/C17H20N2O5/c1-4-12-7-9-13(10-8-12)18-17(22)19-14(16(21)24-6-3)11-15(20)23-5-2/h1,7-10,14H,5-6,11H2,2-3H3,(H2,18,19,22)/t14-/m0/s1 |
| InChIKey | SWOJAGPKEXFQDW-AWEZNQCLSA-N |
| XLogP | 1.67 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|