C29H26N4O4 — CID 59499602
butyl 3,5-bis[(4-ethynylphenyl)carbamoylamino]benzoate (PubChem CID 59499602) has the molecular formula C29H26N4O4 and a molecular weight of 494.55 g/mol. Its IUPAC name is butyl 3,5-bis[(4-ethynylphenyl)carbamoylamino]benzoate.
| Compound Name | butyl 3,5-bis[(4-ethynylphenyl)carbamoylamino]benzoate |
|---|---|
| PubChem CID | 59499602 |
| Molecular Formula | C29H26N4O4 |
| Molecular Weight | 494.55 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | butyl 3,5-bis[(4-ethynylphenyl)carbamoylamino]benzoate |
| SMILES | C#Cc1ccc(NC(=O)Nc2cc(NC(=O)Nc3ccc(C#C)cc3)cc(C(=O)OCCCC)c2)cc1 |
| InChI | InChI=1S/C29H26N4O4/c1-4-7-16-37-27(34)22-17-25(32-28(35)30-23-12-8-20(5-2)9-13-23)19-26(18-22)33-29(36)31-24-14-10-21(6-3)11-15-24/h2-3,8-15,17-19H,4,7,16H2,1H3,(H2,30,32,35)(H2,31,33,36) |
| InChIKey | DHKHDLTXQCPFCG-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.55 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|