C48H64N2O6 — CID 162240392
decyl acetate;decyl 2-[(4-ethynylphenyl)carbamoyl]benzoate;N-(4-ethynylphenyl)acetamide (PubChem CID 162240392) has the molecular formula C48H64N2O6 and a molecular weight of 765.05 g/mol. Its IUPAC name is decyl acetate;decyl 2-[(4-ethynylphenyl)carbamoyl]benzoate;N-(4-ethynylphenyl)acetamide.
| Compound Name | decyl acetate;decyl 2-[(4-ethynylphenyl)carbamoyl]benzoate;N-(4-ethynylphenyl)acetamide |
|---|---|
| PubChem CID | 162240392 |
| Molecular Formula | C48H64N2O6 |
| Molecular Weight | 765.05 g/mol |
| Exact Mass | 764.48 |
| IUPAC Name | decyl acetate;decyl 2-[(4-ethynylphenyl)carbamoyl]benzoate;N-(4-ethynylphenyl)acetamide |
| SMILES | C#Cc1ccc(NC(=O)c2ccccc2C(=O)OCCCCCCCCCC)cc1.C#Cc1ccc(NC(C)=O)cc1.CCCCCCCCCCOC(C)=O |
| InChI | InChI=1S/C26H31NO3.C12H24O2.C10H9NO/c1-3-5-6-7-8-9-10-13-20-30-26(29)24-15-12-11-14-23(24)25(28)27-22-18-16-21(4-2)17-19-22;1-3-4-5-6-7-8-9-10-11-14-12(2)13;1-3-9-4-6-10(7-5-9)11-8(2)12/h2,11-12,14-19H,3,5-10,13,20H2,1H3,(H,27,28);3-11H2,1-2H3;1,4-7H,2H3,(H,11,12) |
| InChIKey | ZWPSMXPSZZTUTB-UHFFFAOYSA-N |
| XLogP | 11.53 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.05 |
| LogP ≤ 5 | 11.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|