C48H64N2O6 — CID 159227146
decyl 2-[[4-[(2-decoxycarbonylbenzoyl)amino]phenyl]carbamoyl]benzoate;bis(prop-1-yne) (PubChem CID 159227146) has the molecular formula C48H64N2O6 and a molecular weight of 765.05 g/mol. Its IUPAC name is decyl 2-[[4-[(2-decoxycarbonylbenzoyl)amino]phenyl]carbamoyl]benzoate;bis(prop-1-yne).
| Compound Name | decyl 2-[[4-[(2-decoxycarbonylbenzoyl)amino]phenyl]carbamoyl]benzoate;bis(prop-1-yne) |
|---|---|
| PubChem CID | 159227146 |
| Molecular Formula | C48H64N2O6 |
| Molecular Weight | 765.05 g/mol |
| Exact Mass | 764.48 |
| IUPAC Name | decyl 2-[[4-[(2-decoxycarbonylbenzoyl)amino]phenyl]carbamoyl]benzoate;bis(prop-1-yne) |
| SMILES | C#CC.C#CC.CCCCCCCCCCOC(=O)c1ccccc1C(=O)Nc1ccc(NC(=O)c2ccccc2C(=O)OCCCCCCCCCC)cc1 |
| InChI | InChI=1S/C42H56N2O6.2C3H4/c1-3-5-7-9-11-13-15-21-31-49-41(47)37-25-19-17-23-35(37)39(45)43-33-27-29-34(30-28-33)44-40(46)36-24-18-20-26-38(36)42(48)50-32-22-16-14-12-10-8-6-4-2;2*1-3-2/h17-20,23-30H,3-16,21-22,31-32H2,1-2H3,(H,43,45)(H,44,46);2*1H,2H3 |
| InChIKey | KSKWSPZEZMAIDH-UHFFFAOYSA-N |
| XLogP | 12.07 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.05 |
| LogP ≤ 5 | 12.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|