C21H22NO5- — CID 3544823
2-[(4-hexoxycarbonylphenyl)carbamoyl]benzoate (PubChem CID 3544823) has the molecular formula C21H22NO5- and a molecular weight of 368.41 g/mol. Its IUPAC name is 2-[(4-hexoxycarbonylphenyl)carbamoyl]benzoate.
| Compound Name | 2-[(4-hexoxycarbonylphenyl)carbamoyl]benzoate |
|---|---|
| PubChem CID | 3544823 |
| Molecular Formula | C21H22NO5- |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 2-[(4-hexoxycarbonylphenyl)carbamoyl]benzoate |
| SMILES | CCCCCCOC(=O)c1ccc(NC(=O)c2ccccc2C(=O)[O-])cc1 |
| InChI | InChI=1S/C21H23NO5/c1-2-3-4-7-14-27-21(26)15-10-12-16(13-11-15)22-19(23)17-8-5-6-9-18(17)20(24)25/h5-6,8-13H,2-4,7,14H2,1H3,(H,22,23)(H,24,25)/p-1 |
| InChIKey | OHBBESDMERRCOE-UHFFFAOYSA-M |
| XLogP | 3.04 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|