C33H51N2O4+ — CID 154676643
diethyl-[2-[4-[(2-octoxybenzoyl)amino]benzoyl]oxyethyl]-pentylazanium (PubChem CID 154676643) has the molecular formula C33H51N2O4+ and a molecular weight of 539.78 g/mol. Its IUPAC name is diethyl-[2-[4-[(2-octoxybenzoyl)amino]benzoyl]oxyethyl]-pentylazanium.
| Compound Name | diethyl-[2-[4-[(2-octoxybenzoyl)amino]benzoyl]oxyethyl]-pentylazanium |
|---|---|
| PubChem CID | 154676643 |
| Molecular Formula | C33H51N2O4+ |
| Molecular Weight | 539.78 g/mol |
| Exact Mass | 539.38 |
| IUPAC Name | diethyl-[2-[4-[(2-octoxybenzoyl)amino]benzoyl]oxyethyl]-pentylazanium |
| SMILES | CCCCCCCCOc1ccccc1C(=O)Nc1ccc(C(=O)OCC[N+](CC)(CC)CCCCC)cc1 |
| InChI | InChI=1S/C33H50N2O4/c1-5-9-11-12-13-17-26-38-31-19-15-14-18-30(31)32(36)34-29-22-20-28(21-23-29)33(37)39-27-25-35(7-3,8-4)24-16-10-6-2/h14-15,18-23H,5-13,16-17,24-27H2,1-4H3/p+1 |
| InChIKey | QRUFGKLYJXPHED-UHFFFAOYSA-O |
| XLogP | 7.88 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.78 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|