C32H47N2O4+ — CID 154676476
cyclopropylmethyl-diethyl-[2-[4-[(2-octoxybenzoyl)amino]benzoyl]oxyethyl]azanium (PubChem CID 154676476) has the molecular formula C32H47N2O4+ and a molecular weight of 523.74 g/mol. Its IUPAC name is cyclopropylmethyl-diethyl-[2-[4-[(2-octoxybenzoyl)amino]benzoyl]oxyethyl]azanium.
| Compound Name | cyclopropylmethyl-diethyl-[2-[4-[(2-octoxybenzoyl)amino]benzoyl]oxyethyl]azanium |
|---|---|
| PubChem CID | 154676476 |
| Molecular Formula | C32H47N2O4+ |
| Molecular Weight | 523.74 g/mol |
| Exact Mass | 523.35 |
| IUPAC Name | cyclopropylmethyl-diethyl-[2-[4-[(2-octoxybenzoyl)amino]benzoyl]oxyethyl]azanium |
| SMILES | CCCCCCCCOc1ccccc1C(=O)Nc1ccc(C(=O)OCC[N+](CC)(CC)CC2CC2)cc1 |
| InChI | InChI=1S/C32H46N2O4/c1-4-7-8-9-10-13-23-37-30-15-12-11-14-29(30)31(35)33-28-20-18-27(19-21-28)32(36)38-24-22-34(5-2,6-3)25-26-16-17-26/h11-12,14-15,18-21,26H,4-10,13,16-17,22-25H2,1-3H3/p+1 |
| InChIKey | OYCLQJSQDRJWJT-UHFFFAOYSA-O |
| XLogP | 7.10 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.74 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|