C35H47BrN3O7+ — CID 154676599
diethyl-[(4-nitrophenyl)methyl]-[2-[4-[(2-octoxybenzoyl)amino]benzoyl]oxyethyl]azanium;hypobromous acid (PubChem CID 154676599) has the molecular formula C35H47BrN3O7+ and a molecular weight of 701.68 g/mol. Its IUPAC name is diethyl-[(4-nitrophenyl)methyl]-[2-[4-[(2-octoxybenzoyl)amino]benzoyl]oxyethyl]azanium;hypobromous acid.
| Compound Name | diethyl-[(4-nitrophenyl)methyl]-[2-[4-[(2-octoxybenzoyl)amino]benzoyl]oxyethyl]azanium;hypobromous acid |
|---|---|
| PubChem CID | 154676599 |
| Molecular Formula | C35H47BrN3O7+ |
| Molecular Weight | 701.68 g/mol |
| Exact Mass | 700.26 |
| IUPAC Name | diethyl-[(4-nitrophenyl)methyl]-[2-[4-[(2-octoxybenzoyl)amino]benzoyl]oxyethyl]azanium;hypobromous acid |
| SMILES | CCCCCCCCOc1ccccc1C(=O)Nc1ccc(C(=O)OCC[N+](CC)(CC)Cc2ccc([N+](=O)[O-])cc2)cc1.OBr |
| InChI | InChI=1S/C35H45N3O6.BrHO/c1-4-7-8-9-10-13-25-43-33-15-12-11-14-32(33)34(39)36-30-20-18-29(19-21-30)35(40)44-26-24-38(5-2,6-3)27-28-16-22-31(23-17-28)37(41)42;1-2/h11-12,14-23H,4-10,13,24-27H2,1-3H3;2H/p+1 |
| InChIKey | PQWAEWYAYLYWHI-UHFFFAOYSA-O |
| XLogP | 8.09 |
| TPSA | 128.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.68 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|