C36H48BrF2N2O5+ — CID 154676601
(2,3-difluorophenyl)methyl-diethyl-[2-[4-[(2-octoxybenzoyl)amino]benzoyl]oxyethyl]azanium;methyl hypobromite (PubChem CID 154676601) has the molecular formula C36H48BrF2N2O5+ and a molecular weight of 706.69 g/mol. Its IUPAC name is (2,3-difluorophenyl)methyl-diethyl-[2-[4-[(2-octoxybenzoyl)amino]benzoyl]oxyethyl]azanium;methyl hypobromite.
| Compound Name | (2,3-difluorophenyl)methyl-diethyl-[2-[4-[(2-octoxybenzoyl)amino]benzoyl]oxyethyl]azanium;methyl hypobromite |
|---|---|
| PubChem CID | 154676601 |
| Molecular Formula | C36H48BrF2N2O5+ |
| Molecular Weight | 706.69 g/mol |
| Exact Mass | 705.27 |
| IUPAC Name | (2,3-difluorophenyl)methyl-diethyl-[2-[4-[(2-octoxybenzoyl)amino]benzoyl]oxyethyl]azanium;methyl hypobromite |
| SMILES | CCCCCCCCOc1ccccc1C(=O)Nc1ccc(C(=O)OCC[N+](CC)(CC)Cc2cccc(F)c2F)cc1.COBr |
| InChI | InChI=1S/C35H44F2N2O4.CH3BrO/c1-4-7-8-9-10-13-24-42-32-18-12-11-16-30(32)34(40)38-29-21-19-27(20-22-29)35(41)43-25-23-39(5-2,6-3)26-28-15-14-17-31(36)33(28)37;1-3-2/h11-12,14-22H,4-10,13,23-26H2,1-3H3;1H3/p+1 |
| InChIKey | BRLVYXAMTZKPKJ-UHFFFAOYSA-O |
| XLogP | 9.11 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.69 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|