C29H42BrFN2O4 — CID 154676379
diethyl-[2-[4-[(3-fluoro-2-octoxybenzoyl)amino]benzoyl]oxyethyl]-methylazanium bromide (PubChem CID 154676379) has the molecular formula C29H42BrFN2O4 and a molecular weight of 581.57 g/mol. Its IUPAC name is diethyl-[2-[4-[(3-fluoro-2-octoxybenzoyl)amino]benzoyl]oxyethyl]-methylazanium bromide.
| Compound Name | diethyl-[2-[4-[(3-fluoro-2-octoxybenzoyl)amino]benzoyl]oxyethyl]-methylazanium bromide |
|---|---|
| PubChem CID | 154676379 |
| Molecular Formula | C29H42BrFN2O4 |
| Molecular Weight | 581.57 g/mol |
| Exact Mass | 580.23 |
| IUPAC Name | diethyl-[2-[4-[(3-fluoro-2-octoxybenzoyl)amino]benzoyl]oxyethyl]-methylazanium bromide |
| SMILES | CCCCCCCCOc1c(F)cccc1C(=O)Nc1ccc(C(=O)OCC[N+](C)(CC)CC)cc1.[Br-] |
| InChI | InChI=1S/C29H41FN2O4.BrH/c1-5-8-9-10-11-12-21-35-27-25(14-13-15-26(27)30)28(33)31-24-18-16-23(17-19-24)29(34)36-22-20-32(4,6-2)7-3;/h13-19H,5-12,20-22H2,1-4H3;1H |
| InChIKey | WVYGHPQJOFZGHW-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.57 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|