C38H63N2O6+ — CID 154676541
2-[4-[(2,5-dioctoxybenzoyl)amino]benzoyl]oxyethyl-diethyl-methylazanium;methanol (PubChem CID 154676541) has the molecular formula C38H63N2O6+ and a molecular weight of 643.93 g/mol. Its IUPAC name is 2-[4-[(2,5-dioctoxybenzoyl)amino]benzoyl]oxyethyl-diethyl-methylazanium;methanol.
| Compound Name | 2-[4-[(2,5-dioctoxybenzoyl)amino]benzoyl]oxyethyl-diethyl-methylazanium;methanol |
|---|---|
| PubChem CID | 154676541 |
| Molecular Formula | C38H63N2O6+ |
| Molecular Weight | 643.93 g/mol |
| Exact Mass | 643.47 |
| IUPAC Name | 2-[4-[(2,5-dioctoxybenzoyl)amino]benzoyl]oxyethyl-diethyl-methylazanium;methanol |
| SMILES | CCCCCCCCOc1ccc(OCCCCCCCC)c(C(=O)Nc2ccc(C(=O)OCC[N+](C)(CC)CC)cc2)c1.CO |
| InChI | InChI=1S/C37H58N2O5.CH4O/c1-6-10-12-14-16-18-27-42-33-24-25-35(43-28-19-17-15-13-11-7-2)34(30-33)36(40)38-32-22-20-31(21-23-32)37(41)44-29-26-39(5,8-3)9-4;1-2/h20-25,30H,6-19,26-29H2,1-5H3;2H,1H3/p+1 |
| InChIKey | VAURFOFOQNCCEQ-UHFFFAOYSA-O |
| XLogP | 8.67 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.93 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|