C28H43N2O5+ — CID 154676436
diethyl-[2-[4-[(2-hexoxybenzoyl)amino]benzoyl]oxyethyl]-methylazanium;methanol (PubChem CID 154676436) has the molecular formula C28H43N2O5+ and a molecular weight of 487.66 g/mol. Its IUPAC name is diethyl-[2-[4-[(2-hexoxybenzoyl)amino]benzoyl]oxyethyl]-methylazanium;methanol.
| Compound Name | diethyl-[2-[4-[(2-hexoxybenzoyl)amino]benzoyl]oxyethyl]-methylazanium;methanol |
|---|---|
| PubChem CID | 154676436 |
| Molecular Formula | C28H43N2O5+ |
| Molecular Weight | 487.66 g/mol |
| Exact Mass | 487.32 |
| IUPAC Name | diethyl-[2-[4-[(2-hexoxybenzoyl)amino]benzoyl]oxyethyl]-methylazanium;methanol |
| SMILES | CCCCCCOc1ccccc1C(=O)Nc1ccc(C(=O)OCC[N+](C)(CC)CC)cc1.CO |
| InChI | InChI=1S/C27H38N2O4.CH4O/c1-5-8-9-12-20-32-25-14-11-10-13-24(25)26(30)28-23-17-15-22(16-18-23)27(31)33-21-19-29(4,6-2)7-3;1-2/h10-11,13-18H,5-9,12,19-21H2,1-4H3;2H,1H3/p+1 |
| InChIKey | BHISOEJUCKQYTI-UHFFFAOYSA-O |
| XLogP | 5.15 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.66 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|