C29H42FN2O4+ — CID 154676401
diethyl-[2-[3-fluoro-4-[(2-octoxybenzoyl)amino]benzoyl]oxyethyl]-methylazanium (PubChem CID 154676401) has the molecular formula C29H42FN2O4+ and a molecular weight of 501.66 g/mol. Its IUPAC name is diethyl-[2-[3-fluoro-4-[(2-octoxybenzoyl)amino]benzoyl]oxyethyl]-methylazanium.
| Compound Name | diethyl-[2-[3-fluoro-4-[(2-octoxybenzoyl)amino]benzoyl]oxyethyl]-methylazanium |
|---|---|
| PubChem CID | 154676401 |
| Molecular Formula | C29H42FN2O4+ |
| Molecular Weight | 501.66 g/mol |
| Exact Mass | 501.31 |
| IUPAC Name | diethyl-[2-[3-fluoro-4-[(2-octoxybenzoyl)amino]benzoyl]oxyethyl]-methylazanium |
| SMILES | CCCCCCCCOc1ccccc1C(=O)Nc1ccc(C(=O)OCC[N+](C)(CC)CC)cc1F |
| InChI | InChI=1S/C29H41FN2O4/c1-5-8-9-10-11-14-20-35-27-16-13-12-15-24(27)28(33)31-26-18-17-23(22-25(26)30)29(34)36-21-19-32(4,6-2)7-3/h12-13,15-18,22H,5-11,14,19-21H2,1-4H3/p+1 |
| InChIKey | AYFXWHQLKHJNTN-UHFFFAOYSA-O |
| XLogP | 6.46 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.66 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|