C28H42N3O3+ — CID 154676514
diethyl-[2-[[4-[(2-heptoxybenzoyl)amino]benzoyl]amino]ethyl]-methylazanium (PubChem CID 154676514) has the molecular formula C28H42N3O3+ and a molecular weight of 468.66 g/mol. Its IUPAC name is diethyl-[2-[[4-[(2-heptoxybenzoyl)amino]benzoyl]amino]ethyl]-methylazanium.
| Compound Name | diethyl-[2-[[4-[(2-heptoxybenzoyl)amino]benzoyl]amino]ethyl]-methylazanium |
|---|---|
| PubChem CID | 154676514 |
| Molecular Formula | C28H42N3O3+ |
| Molecular Weight | 468.66 g/mol |
| Exact Mass | 468.32 |
| IUPAC Name | diethyl-[2-[[4-[(2-heptoxybenzoyl)amino]benzoyl]amino]ethyl]-methylazanium |
| SMILES | CCCCCCCOc1ccccc1C(=O)Nc1ccc(C(=O)NCC[N+](C)(CC)CC)cc1 |
| InChI | InChI=1S/C28H41N3O3/c1-5-8-9-10-13-22-34-26-15-12-11-14-25(26)28(33)30-24-18-16-23(17-19-24)27(32)29-20-21-31(4,6-2)7-3/h11-12,14-19H,5-10,13,20-22H2,1-4H3,(H-,29,30,32,33)/p+1 |
| InChIKey | WTPITUHNEKYMGC-UHFFFAOYSA-O |
| XLogP | 5.50 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.66 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|