C29H44BrN3O3 — CID 138399753
N-[2-[diethyl(methyl)azaniumyl]ethyl]-4-[(2-octoxybenzoyl)amino]benzenecarboximidate;hydrobromide (PubChem CID 138399753) has the molecular formula C29H44BrN3O3 and a molecular weight of 562.59 g/mol. Its IUPAC name is N-[2-[diethyl(methyl)azaniumyl]ethyl]-4-[(2-octoxybenzoyl)amino]benzenecarboximidate;hydrobromide.
| Compound Name | N-[2-[diethyl(methyl)azaniumyl]ethyl]-4-[(2-octoxybenzoyl)amino]benzenecarboximidate;hydrobromide |
|---|---|
| PubChem CID | 138399753 |
| Molecular Formula | C29H44BrN3O3 |
| Molecular Weight | 562.59 g/mol |
| Exact Mass | 561.26 |
| IUPAC Name | N-[2-[diethyl(methyl)azaniumyl]ethyl]-4-[(2-octoxybenzoyl)amino]benzenecarboximidate;hydrobromide |
| SMILES | Br.CCCCCCCCOc1ccccc1C(=O)Nc1ccc(/C([O-])=N/CC[N+](C)(CC)CC)cc1 |
| InChI | InChI=1S/C29H43N3O3.BrH/c1-5-8-9-10-11-14-23-35-27-16-13-12-15-26(27)29(34)31-25-19-17-24(18-20-25)28(33)30-21-22-32(4,6-2)7-3;/h12-13,15-20H,5-11,14,21-23H2,1-4H3,(H-,30,31,33,34);1H |
| InChIKey | JDHRFYGIZSEITO-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 73.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.59 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|