C30H45N2O4+ — CID 169437973
ethyl-methyl-[2-[4-[(2-nonoxybenzoyl)amino]benzoyl]oxyethyl]-(1,1,2,2,2-pentadeuterioethyl)azanium (PubChem CID 169437973) has the molecular formula C30H45N2O4+ and a molecular weight of 502.73 g/mol. Its IUPAC name is ethyl-methyl-[2-[4-[(2-nonoxybenzoyl)amino]benzoyl]oxyethyl]-(1,1,2,2,2-pentadeuterioethyl)azanium.
| Compound Name | ethyl-methyl-[2-[4-[(2-nonoxybenzoyl)amino]benzoyl]oxyethyl]-(1,1,2,2,2-pentadeuterioethyl)azanium |
|---|---|
| PubChem CID | 169437973 |
| Molecular Formula | C30H45N2O4+ |
| Molecular Weight | 502.73 g/mol |
| Exact Mass | 502.37 |
| IUPAC Name | ethyl-methyl-[2-[4-[(2-nonoxybenzoyl)amino]benzoyl]oxyethyl]-(1,1,2,2,2-pentadeuterioethyl)azanium |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])[N+](C)(CC)CCOC(=O)c1ccc(NC(=O)c2ccccc2OCCCCCCCCC)cc1 |
| InChI | InChI=1S/C30H44N2O4/c1-5-8-9-10-11-12-15-23-35-28-17-14-13-16-27(28)29(33)31-26-20-18-25(19-21-26)30(34)36-24-22-32(4,6-2)7-3/h13-14,16-21H,5-12,15,22-24H2,1-4H3/p+1/i2D3,6D2 |
| InChIKey | ODUGJQZZYNNHNI-QKLSXCJMSA-O |
| XLogP | 6.71 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.73 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|