C35H57N2O4+ — CID 154676632
diethyl-[4-[4-[(2-octoxybenzoyl)amino]phenyl]-4-oxobutyl]-pentylazanium;methanol (PubChem CID 154676632) has the molecular formula C35H57N2O4+ and a molecular weight of 569.85 g/mol. Its IUPAC name is diethyl-[4-[4-[(2-octoxybenzoyl)amino]phenyl]-4-oxobutyl]-pentylazanium;methanol.
| Compound Name | diethyl-[4-[4-[(2-octoxybenzoyl)amino]phenyl]-4-oxobutyl]-pentylazanium;methanol |
|---|---|
| PubChem CID | 154676632 |
| Molecular Formula | C35H57N2O4+ |
| Molecular Weight | 569.85 g/mol |
| Exact Mass | 569.43 |
| IUPAC Name | diethyl-[4-[4-[(2-octoxybenzoyl)amino]phenyl]-4-oxobutyl]-pentylazanium;methanol |
| SMILES | CCCCCCCCOc1ccccc1C(=O)Nc1ccc(C(=O)CCC[N+](CC)(CC)CCCCC)cc1.CO |
| InChI | InChI=1S/C34H52N2O3.CH4O/c1-5-9-11-12-13-17-28-39-33-21-15-14-19-31(33)34(38)35-30-24-22-29(23-25-30)32(37)20-18-27-36(7-3,8-4)26-16-10-6-2;1-2/h14-15,19,21-25H,5-13,16-18,20,26-28H2,1-4H3;2H,1H3/p+1 |
| InChIKey | JVFSUVJIBLDWAE-UHFFFAOYSA-O |
| XLogP | 8.30 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.85 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|