C30H48N3O2S+ — CID 154676624
diethyl-[2-[[4-[(2-hexoxybenzoyl)amino]phenyl]sulfanylamino]ethyl]-pentylazanium (PubChem CID 154676624) has the molecular formula C30H48N3O2S+ and a molecular weight of 514.80 g/mol. Its IUPAC name is diethyl-[2-[[4-[(2-hexoxybenzoyl)amino]phenyl]sulfanylamino]ethyl]-pentylazanium.
| Compound Name | diethyl-[2-[[4-[(2-hexoxybenzoyl)amino]phenyl]sulfanylamino]ethyl]-pentylazanium |
|---|---|
| PubChem CID | 154676624 |
| Molecular Formula | C30H48N3O2S+ |
| Molecular Weight | 514.80 g/mol |
| Exact Mass | 514.35 |
| IUPAC Name | diethyl-[2-[[4-[(2-hexoxybenzoyl)amino]phenyl]sulfanylamino]ethyl]-pentylazanium |
| SMILES | CCCCCCOc1ccccc1C(=O)Nc1ccc(SNCC[N+](CC)(CC)CCCCC)cc1 |
| InChI | InChI=1S/C30H47N3O2S/c1-5-9-11-15-25-35-29-17-13-12-16-28(29)30(34)32-26-18-20-27(21-19-26)36-31-22-24-33(7-3,8-4)23-14-10-6-2/h12-13,16-21,31H,5-11,14-15,22-25H2,1-4H3/p+1 |
| InChIKey | BKHVYLJEWAAGCN-UHFFFAOYSA-O |
| XLogP | 7.54 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.80 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|