C31H51FN3O3S+ — CID 154676596
diethyl-[2-[[4-[(4-fluoro-2-hexoxybenzoyl)amino]phenyl]sulfanylamino]ethyl]-pentylazanium;methanol (PubChem CID 154676596) has the molecular formula C31H51FN3O3S+ and a molecular weight of 564.83 g/mol. Its IUPAC name is diethyl-[2-[[4-[(4-fluoro-2-hexoxybenzoyl)amino]phenyl]sulfanylamino]ethyl]-pentylazanium;methanol.
| Compound Name | diethyl-[2-[[4-[(4-fluoro-2-hexoxybenzoyl)amino]phenyl]sulfanylamino]ethyl]-pentylazanium;methanol |
|---|---|
| PubChem CID | 154676596 |
| Molecular Formula | C31H51FN3O3S+ |
| Molecular Weight | 564.83 g/mol |
| Exact Mass | 564.36 |
| IUPAC Name | diethyl-[2-[[4-[(4-fluoro-2-hexoxybenzoyl)amino]phenyl]sulfanylamino]ethyl]-pentylazanium;methanol |
| SMILES | CCCCCCOc1cc(F)ccc1C(=O)Nc1ccc(SNCC[N+](CC)(CC)CCCCC)cc1.CO |
| InChI | InChI=1S/C30H46FN3O2S.CH4O/c1-5-9-11-13-23-36-29-24-25(31)14-19-28(29)30(35)33-26-15-17-27(18-16-26)37-32-20-22-34(7-3,8-4)21-12-10-6-2;1-2/h14-19,24,32H,5-13,20-23H2,1-4H3;2H,1H3/p+1 |
| InChIKey | OEHIENQCNGOZJW-UHFFFAOYSA-O |
| XLogP | 7.29 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.83 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|