C23H31NO4 — CID 17340669
2,4-diethoxy-N-(4-hexoxyphenyl)benzamide (PubChem CID 17340669) has the molecular formula C23H31NO4 and a molecular weight of 385.50 g/mol. Its IUPAC name is 2,4-diethoxy-N-(4-hexoxyphenyl)benzamide.
| Compound Name | 2,4-diethoxy-N-(4-hexoxyphenyl)benzamide |
|---|---|
| PubChem CID | 17340669 |
| Molecular Formula | C23H31NO4 |
| Molecular Weight | 385.50 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | 2,4-diethoxy-N-(4-hexoxyphenyl)benzamide |
| SMILES | CCCCCCOc1ccc(NC(=O)c2ccc(OCC)cc2OCC)cc1 |
| InChI | InChI=1S/C23H31NO4/c1-4-7-8-9-16-28-19-12-10-18(11-13-19)24-23(25)21-15-14-20(26-5-2)17-22(21)27-6-3/h10-15,17H,4-9,16H2,1-3H3,(H,24,25) |
| InChIKey | NZAFCAZFSQAHOY-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.50 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|