C24H33NO4 — CID 17340675
2,4-diethoxy-N-(4-heptoxyphenyl)benzamide (PubChem CID 17340675) has the molecular formula C24H33NO4 and a molecular weight of 399.53 g/mol. Its IUPAC name is 2,4-diethoxy-N-(4-heptoxyphenyl)benzamide.
| Compound Name | 2,4-diethoxy-N-(4-heptoxyphenyl)benzamide |
|---|---|
| PubChem CID | 17340675 |
| Molecular Formula | C24H33NO4 |
| Molecular Weight | 399.53 g/mol |
| Exact Mass | 399.24 |
| IUPAC Name | 2,4-diethoxy-N-(4-heptoxyphenyl)benzamide |
| SMILES | CCCCCCCOc1ccc(NC(=O)c2ccc(OCC)cc2OCC)cc1 |
| InChI | InChI=1S/C24H33NO4/c1-4-7-8-9-10-17-29-20-13-11-19(12-14-20)25-24(26)22-16-15-21(27-5-2)18-23(22)28-6-3/h11-16,18H,4-10,17H2,1-3H3,(H,25,26) |
| InChIKey | DJCQQCWKIMAPAO-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.53 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|