C19H22I3N3O7 — CID 54185975
diethyl 2-[(3,5-diacetamido-2,4,6-triiodobenzoyl)amino]butanedioate (PubChem CID 54185975) has the molecular formula C19H22I3N3O7 and a molecular weight of 785.11 g/mol. Its IUPAC name is diethyl 2-[(3,5-diacetamido-2,4,6-triiodobenzoyl)amino]butanedioate.
| Compound Name | diethyl 2-[(3,5-diacetamido-2,4,6-triiodobenzoyl)amino]butanedioate |
|---|---|
| PubChem CID | 54185975 |
| Molecular Formula | C19H22I3N3O7 |
| Molecular Weight | 785.11 g/mol |
| Exact Mass | 784.86 |
| IUPAC Name | diethyl 2-[(3,5-diacetamido-2,4,6-triiodobenzoyl)amino]butanedioate |
| SMILES | CCOC(=O)CC(NC(=O)c1c(I)c(NC(C)=O)c(I)c(NC(C)=O)c1I)C(=O)OCC |
| InChI | InChI=1S/C19H22I3N3O7/c1-5-31-11(28)7-10(19(30)32-6-2)25-18(29)12-13(20)16(23-8(3)26)15(22)17(14(12)21)24-9(4)27/h10H,5-7H2,1-4H3,(H,23,26)(H,24,27)(H,25,29) |
| InChIKey | PFDFAZSTMHEFAB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 139.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.11 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|