C15H16I3N3O5 — CID 23362642
[2-(ethylamino)-2-oxoethyl] 3,5-diacetamido-2,4,6-triiodobenzoate (PubChem CID 23362642) has the molecular formula C15H16I3N3O5 and a molecular weight of 699.02 g/mol. Its IUPAC name is [2-(ethylamino)-2-oxoethyl] 3,5-diacetamido-2,4,6-triiodobenzoate.
| Compound Name | [2-(ethylamino)-2-oxoethyl] 3,5-diacetamido-2,4,6-triiodobenzoate |
|---|---|
| PubChem CID | 23362642 |
| Molecular Formula | C15H16I3N3O5 |
| Molecular Weight | 699.02 g/mol |
| Exact Mass | 698.82 |
| IUPAC Name | [2-(ethylamino)-2-oxoethyl] 3,5-diacetamido-2,4,6-triiodobenzoate |
| SMILES | CCNC(=O)COC(=O)c1c(I)c(NC(C)=O)c(I)c(NC(C)=O)c1I |
| InChI | InChI=1S/C15H16I3N3O5/c1-4-19-8(24)5-26-15(25)9-10(16)13(20-6(2)22)12(18)14(11(9)17)21-7(3)23/h4-5H2,1-3H3,(H,19,24)(H,20,22)(H,21,23) |
| InChIKey | AUHDUANJILPHLF-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.02 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|