C23H24I3N3O5 — CID 5078667
[2-(4-butan-2-ylanilino)-2-oxoethyl] 3,5-diacetamido-2,4,6-triiodobenzoate (PubChem CID 5078667) has the molecular formula C23H24I3N3O5 and a molecular weight of 803.17 g/mol. Its IUPAC name is [2-(4-butan-2-ylanilino)-2-oxoethyl] 3,5-diacetamido-2,4,6-triiodobenzoate.
| Compound Name | [2-(4-butan-2-ylanilino)-2-oxoethyl] 3,5-diacetamido-2,4,6-triiodobenzoate |
|---|---|
| PubChem CID | 5078667 |
| Molecular Formula | C23H24I3N3O5 |
| Molecular Weight | 803.17 g/mol |
| Exact Mass | 802.89 |
| IUPAC Name | [2-(4-butan-2-ylanilino)-2-oxoethyl] 3,5-diacetamido-2,4,6-triiodobenzoate |
| SMILES | CCC(C)c1ccc(NC(=O)COC(=O)c2c(I)c(NC(C)=O)c(I)c(NC(C)=O)c2I)cc1 |
| InChI | InChI=1S/C23H24I3N3O5/c1-5-11(2)14-6-8-15(9-7-14)29-16(32)10-34-23(33)17-18(24)21(27-12(3)30)20(26)22(19(17)25)28-13(4)31/h6-9,11H,5,10H2,1-4H3,(H,27,30)(H,28,31)(H,29,32) |
| InChIKey | XYBSBAJDRFAEOY-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 803.17 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|