C17H25NO6 — CID 2505134
[2-(ethylamino)-2-oxoethyl] 3,4,5-triethoxybenzoate (PubChem CID 2505134) has the molecular formula C17H25NO6 and a molecular weight of 339.39 g/mol. Its IUPAC name is [2-(ethylamino)-2-oxoethyl] 3,4,5-triethoxybenzoate.
| Compound Name | [2-(ethylamino)-2-oxoethyl] 3,4,5-triethoxybenzoate |
|---|---|
| PubChem CID | 2505134 |
| Molecular Formula | C17H25NO6 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | [2-(ethylamino)-2-oxoethyl] 3,4,5-triethoxybenzoate |
| SMILES | CCNC(=O)COC(=O)c1cc(OCC)c(OCC)c(OCC)c1 |
| InChI | InChI=1S/C17H25NO6/c1-5-18-15(19)11-24-17(20)12-9-13(21-6-2)16(23-8-4)14(10-12)22-7-3/h9-10H,5-8,11H2,1-4H3,(H,18,19) |
| InChIKey | XZJOKFRLOPADQM-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |