C19H29NO6 — CID 7860383
[2-[[(2R)-butan-2-yl]amino]-2-oxoethyl] 3,4,5-triethoxybenzoate (PubChem CID 7860383) has the molecular formula C19H29NO6 and a molecular weight of 367.44 g/mol. Its IUPAC name is [2-[[(2R)-butan-2-yl]amino]-2-oxoethyl] 3,4,5-triethoxybenzoate.
| Compound Name | [2-[[(2R)-butan-2-yl]amino]-2-oxoethyl] 3,4,5-triethoxybenzoate |
|---|---|
| PubChem CID | 7860383 |
| Molecular Formula | C19H29NO6 |
| Molecular Weight | 367.44 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | [2-[[(2R)-butan-2-yl]amino]-2-oxoethyl] 3,4,5-triethoxybenzoate |
| SMILES | CCOc1cc(C(=O)OCC(=O)N[C@H](C)CC)cc(OCC)c1OCC |
| InChI | InChI=1S/C19H29NO6/c1-6-13(5)20-17(21)12-26-19(22)14-10-15(23-7-2)18(25-9-4)16(11-14)24-8-3/h10-11,13H,6-9,12H2,1-5H3,(H,20,21)/t13-/m1/s1 |
| InChIKey | INQBHNVRSFQCNR-CYBMUJFWSA-N |
| XLogP | 2.95 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.44 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |