C17H27NO4 — CID 876684
N-[(2S)-butan-2-yl]-3,4,5-triethoxybenzamide (PubChem CID 876684) has the molecular formula C17H27NO4 and a molecular weight of 309.41 g/mol. Its IUPAC name is N-[(2S)-butan-2-yl]-3,4,5-triethoxybenzamide.
| Compound Name | N-[(2S)-butan-2-yl]-3,4,5-triethoxybenzamide |
|---|---|
| PubChem CID | 876684 |
| Molecular Formula | C17H27NO4 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | N-[(2S)-butan-2-yl]-3,4,5-triethoxybenzamide |
| SMILES | CCOc1cc(C(=O)N[C@@H](C)CC)cc(OCC)c1OCC |
| InChI | InChI=1S/C17H27NO4/c1-6-12(5)18-17(19)13-10-14(20-7-2)16(22-9-4)15(11-13)21-8-3/h10-12H,6-9H2,1-5H3,(H,18,19)/t12-/m0/s1 |
| InChIKey | IYXYXRLHXPTLFG-LBPRGKRZSA-N |
| XLogP | 3.41 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |