C21H26FNO4 — CID 7696716
3,4,5-triethoxy-N-[(1R)-1-(4-fluorophenyl)ethyl]benzamide (PubChem CID 7696716) has the molecular formula C21H26FNO4 and a molecular weight of 375.44 g/mol. Its IUPAC name is 3,4,5-triethoxy-N-[(1R)-1-(4-fluorophenyl)ethyl]benzamide.
| Compound Name | 3,4,5-triethoxy-N-[(1R)-1-(4-fluorophenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 7696716 |
| Molecular Formula | C21H26FNO4 |
| Molecular Weight | 375.44 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | 3,4,5-triethoxy-N-[(1R)-1-(4-fluorophenyl)ethyl]benzamide |
| SMILES | CCOc1cc(C(=O)N[C@H](C)c2ccc(F)cc2)cc(OCC)c1OCC |
| InChI | InChI=1S/C21H26FNO4/c1-5-25-18-12-16(13-19(26-6-2)20(18)27-7-3)21(24)23-14(4)15-8-10-17(22)11-9-15/h8-14H,5-7H2,1-4H3,(H,23,24)/t14-/m1/s1 |
| InChIKey | FHWBKNJWUAOJFH-CQSZACIVSA-N |
| XLogP | 4.51 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.44 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |