C21H25FN2O4 — CID 46414977
N-[2-[1-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl]-4-fluorobenzamide (PubChem CID 46414977) has the molecular formula C21H25FN2O4 and a molecular weight of 388.44 g/mol. Its IUPAC name is N-[2-[1-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl]-4-fluorobenzamide.
| Compound Name | N-[2-[1-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 46414977 |
| Molecular Formula | C21H25FN2O4 |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | N-[2-[1-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl]-4-fluorobenzamide |
| SMILES | CCOc1ccc(C(C)NC(=O)CNC(=O)c2ccc(F)cc2)cc1OCC |
| InChI | InChI=1S/C21H25FN2O4/c1-4-27-18-11-8-16(12-19(18)28-5-2)14(3)24-20(25)13-23-21(26)15-6-9-17(22)10-7-15/h6-12,14H,4-5,13H2,1-3H3,(H,23,26)(H,24,25) |
| InChIKey | OXYLXZDMBWXXRW-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |