C27H30FNO3 — CID 133238912
4-ethoxy-N-[1-(4-fluorophenyl)ethyl]-3-[(2-propan-2-ylphenoxy)methyl]benzamide (PubChem CID 133238912) has the molecular formula C27H30FNO3 and a molecular weight of 435.54 g/mol. Its IUPAC name is 4-ethoxy-N-[1-(4-fluorophenyl)ethyl]-3-[(2-propan-2-ylphenoxy)methyl]benzamide.
| Compound Name | 4-ethoxy-N-[1-(4-fluorophenyl)ethyl]-3-[(2-propan-2-ylphenoxy)methyl]benzamide |
|---|---|
| PubChem CID | 133238912 |
| Molecular Formula | C27H30FNO3 |
| Molecular Weight | 435.54 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | 4-ethoxy-N-[1-(4-fluorophenyl)ethyl]-3-[(2-propan-2-ylphenoxy)methyl]benzamide |
| SMILES | CCOc1ccc(C(=O)NC(C)c2ccc(F)cc2)cc1COc1ccccc1C(C)C |
| InChI | InChI=1S/C27H30FNO3/c1-5-31-25-15-12-21(27(30)29-19(4)20-10-13-23(28)14-11-20)16-22(25)17-32-26-9-7-6-8-24(26)18(2)3/h6-16,18-19H,5,17H2,1-4H3,(H,29,30) |
| InChIKey | ZNDFGINDDFKFFD-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.54 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |