C27H24ClNO3 — CID 133178380
N-[1-(4-chlorophenyl)ethyl]-4-methoxy-3-(naphthalen-2-yloxymethyl)benzamide (PubChem CID 133178380) has the molecular formula C27H24ClNO3 and a molecular weight of 445.95 g/mol. Its IUPAC name is N-[1-(4-chlorophenyl)ethyl]-4-methoxy-3-(naphthalen-2-yloxymethyl)benzamide.
| Compound Name | N-[1-(4-chlorophenyl)ethyl]-4-methoxy-3-(naphthalen-2-yloxymethyl)benzamide |
|---|---|
| PubChem CID | 133178380 |
| Molecular Formula | C27H24ClNO3 |
| Molecular Weight | 445.95 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | N-[1-(4-chlorophenyl)ethyl]-4-methoxy-3-(naphthalen-2-yloxymethyl)benzamide |
| SMILES | COc1ccc(C(=O)NC(C)c2ccc(Cl)cc2)cc1COc1ccc2ccccc2c1 |
| InChI | InChI=1S/C27H24ClNO3/c1-18(19-7-11-24(28)12-8-19)29-27(30)22-10-14-26(31-2)23(15-22)17-32-25-13-9-20-5-3-4-6-21(20)16-25/h3-16,18H,17H2,1-2H3,(H,29,30) |
| InChIKey | WDVPOAWNOPASME-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.95 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |