C23H26ClN3O3 — CID 19467120
3-[(4-chlorophenoxy)methyl]-N-[1-(1-ethyl-5-methylpyrazol-4-yl)ethyl]-4-methoxybenzamide (PubChem CID 19467120) has the molecular formula C23H26ClN3O3 and a molecular weight of 427.93 g/mol. Its IUPAC name is 3-[(4-chlorophenoxy)methyl]-N-[1-(1-ethyl-5-methylpyrazol-4-yl)ethyl]-4-methoxybenzamide.
| Compound Name | 3-[(4-chlorophenoxy)methyl]-N-[1-(1-ethyl-5-methylpyrazol-4-yl)ethyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 19467120 |
| Molecular Formula | C23H26ClN3O3 |
| Molecular Weight | 427.93 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | 3-[(4-chlorophenoxy)methyl]-N-[1-(1-ethyl-5-methylpyrazol-4-yl)ethyl]-4-methoxybenzamide |
| SMILES | CCn1ncc(C(C)NC(=O)c2ccc(OC)c(COc3ccc(Cl)cc3)c2)c1C |
| InChI | InChI=1S/C23H26ClN3O3/c1-5-27-16(3)21(13-25-27)15(2)26-23(28)17-6-11-22(29-4)18(12-17)14-30-20-9-7-19(24)8-10-20/h6-13,15H,5,14H2,1-4H3,(H,26,28) |
| InChIKey | LUQLGDFJNBUVAP-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.93 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |