C24H31ClN2O4 — CID 51954145
N-[[4-[[(2S)-butan-2-yl]carbamoyl]phenyl]methyl]-3-chloro-5-ethoxy-4-propoxybenzamide (PubChem CID 51954145) has the molecular formula C24H31ClN2O4 and a molecular weight of 446.98 g/mol. Its IUPAC name is N-[[4-[[(2S)-butan-2-yl]carbamoyl]phenyl]methyl]-3-chloro-5-ethoxy-4-propoxybenzamide.
| Compound Name | N-[[4-[[(2S)-butan-2-yl]carbamoyl]phenyl]methyl]-3-chloro-5-ethoxy-4-propoxybenzamide |
|---|---|
| PubChem CID | 51954145 |
| Molecular Formula | C24H31ClN2O4 |
| Molecular Weight | 446.98 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | N-[[4-[[(2S)-butan-2-yl]carbamoyl]phenyl]methyl]-3-chloro-5-ethoxy-4-propoxybenzamide |
| SMILES | CCCOc1c(Cl)cc(C(=O)NCc2ccc(C(=O)N[C@@H](C)CC)cc2)cc1OCC |
| InChI | InChI=1S/C24H31ClN2O4/c1-5-12-31-22-20(25)13-19(14-21(22)30-7-3)23(28)26-15-17-8-10-18(11-9-17)24(29)27-16(4)6-2/h8-11,13-14,16H,5-7,12,15H2,1-4H3,(H,26,28)(H,27,29)/t16-/m0/s1 |
| InChIKey | CAWHKHGPAGFXAG-INIZCTEOSA-N |
| XLogP | 4.99 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.98 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |