C17H27ClN2O3 — CID 120652489
3-chloro-5-ethoxy-N-[(2R)-2-(ethylamino)propyl]-4-propoxybenzamide (PubChem CID 120652489) has the molecular formula C17H27ClN2O3 and a molecular weight of 342.87 g/mol. Its IUPAC name is 3-chloro-5-ethoxy-N-[(2R)-2-(ethylamino)propyl]-4-propoxybenzamide.
| Compound Name | 3-chloro-5-ethoxy-N-[(2R)-2-(ethylamino)propyl]-4-propoxybenzamide |
|---|---|
| PubChem CID | 120652489 |
| Molecular Formula | C17H27ClN2O3 |
| Molecular Weight | 342.87 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 3-chloro-5-ethoxy-N-[(2R)-2-(ethylamino)propyl]-4-propoxybenzamide |
| SMILES | CCCOc1c(Cl)cc(C(=O)NC[C@@H](C)NCC)cc1OCC |
| InChI | InChI=1S/C17H27ClN2O3/c1-5-8-23-16-14(18)9-13(10-15(16)22-7-3)17(21)20-11-12(4)19-6-2/h9-10,12,19H,5-8,11H2,1-4H3,(H,20,21)/t12-/m1/s1 |
| InChIKey | JENJRNTYDJZBHX-GFCCVEGCSA-N |
| XLogP | 3.26 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.87 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |