3-hydroxy-2-[(3,4,5-triethoxybenzoyl)amino]propanoic acid

C16H23NO7 — CID 16773565

IUPAC3-hydroxy-2-[(3,4,5-triethoxybenzoyl)amino]propanoic acid
SMILESCCOc1cc(C(=O)NC(CO)C(=O)O)cc(OCC)c1OCC
InChIInChI=1S/C16H23NO7/c1-4-22-12-7-10(15(19)17-11(9-18)16(20)21)8-13(23-5-2)14(12)24-6-3/h7-8,11,18H,4-6,9H2,1-3H3,(H,17,19)(H,20,21)
InChIKeySZJQGODCBQKZAY-UHFFFAOYSA-N
MW341.36 g/mol
LogP1.06
Rot. Bonds10

About 3-hydroxy-2-[(3,4,5-triethoxybenzoyl)amino]propanoic acid

3-hydroxy-2-[(3,4,5-triethoxybenzoyl)amino]propanoic acid (PubChem CID 16773565) has the molecular formula C16H23NO7 and a molecular weight of 341.36 g/mol. Its IUPAC name is 3-hydroxy-2-[(3,4,5-triethoxybenzoyl)amino]propanoic acid.

Molecular Properties

Compound Name3-hydroxy-2-[(3,4,5-triethoxybenzoyl)amino]propanoic acid
PubChem CID16773565
Molecular FormulaC16H23NO7
Molecular Weight341.36 g/mol
Exact Mass341.15
IUPAC Name3-hydroxy-2-[(3,4,5-triethoxybenzoyl)amino]propanoic acid
SMILESCCOc1cc(C(=O)NC(CO)C(=O)O)cc(OCC)c1OCC
InChIInChI=1S/C16H23NO7/c1-4-22-12-7-10(15(19)17-11(9-18)16(20)21)8-13(23-5-2)14(12)24-6-3/h7-8,11,18H,4-6,9H2,1-3H3,(H,17,19)(H,20,21)
InChIKeySZJQGODCBQKZAY-UHFFFAOYSA-N
XLogP1.06
TPSA114.32 Ų
H-Bond Donors3
H-Bond Acceptors6
Rotatable Bonds10
Heavy Atoms24
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500341.36
LogP ≤ 51.06
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 106

Analyze 3-hydroxy-2-[(3,4,5-triethoxybenzoyl)amino]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-hydroxy-2-[(3,4,5-triethoxybenzoyl)amino]propanoic acid?
The IUPAC name of 3-hydroxy-2-[(3,4,5-triethoxybenzoyl)amino]propanoic acid (CID 16773565) is 3-hydroxy-2-[(3,4,5-triethoxybenzoyl)amino]propanoic acid.
What is the SMILES notation for 3-hydroxy-2-[(3,4,5-triethoxybenzoyl)amino]propanoic acid?
The canonical SMILES for 3-hydroxy-2-[(3,4,5-triethoxybenzoyl)amino]propanoic acid is CCOc1cc(C(=O)NC(CO)C(=O)O)cc(OCC)c1OCC.
What is the InChIKey of 3-hydroxy-2-[(3,4,5-triethoxybenzoyl)amino]propanoic acid?
The InChIKey is SZJQGODCBQKZAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23NO7/c1-4-22-12-7-10(15(19)17-11(9-18)16(20)21)8-13(23-5-2)14(12)24-6-3/h7-8,11,18H,4-6,9H2,1-3H3,(H,17,19)(H,20,21).
What are the key properties of 3-hydroxy-2-[(3,4,5-triethoxybenzoyl)amino]propanoic acid?
3-hydroxy-2-[(3,4,5-triethoxybenzoyl)amino]propanoic acid has a molecular weight of 341.36 g/mol, XLogP of 1.06, 10 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-2-[(3,4,5-triethoxybenzoyl)amino]propanoic acid is sourced from PubChem (CID 16773565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).