C16H23NO7 — CID 16773565
3-hydroxy-2-[(3,4,5-triethoxybenzoyl)amino]propanoic acid (PubChem CID 16773565) has the molecular formula C16H23NO7 and a molecular weight of 341.36 g/mol. Its IUPAC name is 3-hydroxy-2-[(3,4,5-triethoxybenzoyl)amino]propanoic acid.
| Compound Name | 3-hydroxy-2-[(3,4,5-triethoxybenzoyl)amino]propanoic acid |
|---|---|
| PubChem CID | 16773565 |
| Molecular Formula | C16H23NO7 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 3-hydroxy-2-[(3,4,5-triethoxybenzoyl)amino]propanoic acid |
| SMILES | CCOc1cc(C(=O)NC(CO)C(=O)O)cc(OCC)c1OCC |
| InChI | InChI=1S/C16H23NO7/c1-4-22-12-7-10(15(19)17-11(9-18)16(20)21)8-13(23-5-2)14(12)24-6-3/h7-8,11,18H,4-6,9H2,1-3H3,(H,17,19)(H,20,21) |
| InChIKey | SZJQGODCBQKZAY-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |