C21H26N2O5 — CID 51308652
N-(2-amino-2-oxo-1-phenylethyl)-3,4,5-triethoxybenzamide (PubChem CID 51308652) has the molecular formula C21H26N2O5 and a molecular weight of 386.45 g/mol. Its IUPAC name is N-(2-amino-2-oxo-1-phenylethyl)-3,4,5-triethoxybenzamide.
| Compound Name | N-(2-amino-2-oxo-1-phenylethyl)-3,4,5-triethoxybenzamide |
|---|---|
| PubChem CID | 51308652 |
| Molecular Formula | C21H26N2O5 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | N-(2-amino-2-oxo-1-phenylethyl)-3,4,5-triethoxybenzamide |
| SMILES | CCOc1cc(C(=O)NC(C(N)=O)c2ccccc2)cc(OCC)c1OCC |
| InChI | InChI=1S/C21H26N2O5/c1-4-26-16-12-15(13-17(27-5-2)19(16)28-6-3)21(25)23-18(20(22)24)14-10-8-7-9-11-14/h7-13,18H,4-6H2,1-3H3,(H2,22,24)(H,23,25) |
| InChIKey | ZUJJEWXXHRWOGT-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |