C23H29NO6 — CID 46483385
methyl 3-phenyl-3-[(3,4,5-triethoxybenzoyl)amino]propanoate (PubChem CID 46483385) has the molecular formula C23H29NO6 and a molecular weight of 415.49 g/mol. Its IUPAC name is methyl 3-phenyl-3-[(3,4,5-triethoxybenzoyl)amino]propanoate.
| Compound Name | methyl 3-phenyl-3-[(3,4,5-triethoxybenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 46483385 |
| Molecular Formula | C23H29NO6 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | methyl 3-phenyl-3-[(3,4,5-triethoxybenzoyl)amino]propanoate |
| SMILES | CCOc1cc(C(=O)NC(CC(=O)OC)c2ccccc2)cc(OCC)c1OCC |
| InChI | InChI=1S/C23H29NO6/c1-5-28-19-13-17(14-20(29-6-2)22(19)30-7-3)23(26)24-18(15-21(25)27-4)16-11-9-8-10-12-16/h8-14,18H,5-7,15H2,1-4H3,(H,24,26) |
| InChIKey | NCMHCKVEYVALCI-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |