C18H16F3NO3 — CID 18797714
methyl 3-benzamido-3-[4-(trifluoromethyl)phenyl]propanoate (PubChem CID 18797714) has the molecular formula C18H16F3NO3 and a molecular weight of 351.32 g/mol. Its IUPAC name is methyl 3-benzamido-3-[4-(trifluoromethyl)phenyl]propanoate.
| Compound Name | methyl 3-benzamido-3-[4-(trifluoromethyl)phenyl]propanoate |
|---|---|
| PubChem CID | 18797714 |
| Molecular Formula | C18H16F3NO3 |
| Molecular Weight | 351.32 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | methyl 3-benzamido-3-[4-(trifluoromethyl)phenyl]propanoate |
| SMILES | COC(=O)CC(NC(=O)c1ccccc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H16F3NO3/c1-25-16(23)11-15(22-17(24)13-5-3-2-4-6-13)12-7-9-14(10-8-12)18(19,20)21/h2-10,15H,11H2,1H3,(H,22,24) |
| InChIKey | XFAPSXHVIOFLPH-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.32 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |