C12H10F3NO2 — CID 2759911
methyl 3-isocyano-3-[4-(trifluoromethyl)phenyl]propanoate (PubChem CID 2759911) has the molecular formula C12H10F3NO2 and a molecular weight of 257.21 g/mol. Its IUPAC name is methyl 3-isocyano-3-[4-(trifluoromethyl)phenyl]propanoate.
| Compound Name | methyl 3-isocyano-3-[4-(trifluoromethyl)phenyl]propanoate |
|---|---|
| PubChem CID | 2759911 |
| Molecular Formula | C12H10F3NO2 |
| Molecular Weight | 257.21 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | methyl 3-isocyano-3-[4-(trifluoromethyl)phenyl]propanoate |
| SMILES | [C-]#[N+]C(CC(=O)OC)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H10F3NO2/c1-16-10(7-11(17)18-2)8-3-5-9(6-4-8)12(13,14)15/h3-6,10H,7H2,2H3 |
| InChIKey | XXKFFFFLIIZCOD-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 30.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.21 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|