C10H10F3NO2 — CID 93280035
(2R)-2-(methylamino)-2-[4-(trifluoromethyl)phenyl]acetic acid (PubChem CID 93280035) has the molecular formula C10H10F3NO2 and a molecular weight of 233.19 g/mol. Its IUPAC name is (2R)-2-(methylamino)-2-[4-(trifluoromethyl)phenyl]acetic acid.
| Compound Name | (2R)-2-(methylamino)-2-[4-(trifluoromethyl)phenyl]acetic acid |
|---|---|
| PubChem CID | 93280035 |
| Molecular Formula | C10H10F3NO2 |
| Molecular Weight | 233.19 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | (2R)-2-(methylamino)-2-[4-(trifluoromethyl)phenyl]acetic acid |
| SMILES | CN[C@@H](C(=O)O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C10H10F3NO2/c1-14-8(9(15)16)6-2-4-7(5-3-6)10(11,12)13/h2-5,8,14H,1H3,(H,15,16)/t8-/m1/s1 |
| InChIKey | WUNPURZYXCZCPK-MRVPVSSYSA-N |
| XLogP | 2.05 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.19 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |