C17H13F6NO2 — CID 25107037
(2S)-2-amino-3,3-bis[4-(trifluoromethyl)phenyl]propanoic acid (PubChem CID 25107037) has the molecular formula C17H13F6NO2 and a molecular weight of 377.28 g/mol. Its IUPAC name is (2S)-2-amino-3,3-bis[4-(trifluoromethyl)phenyl]propanoic acid.
| Compound Name | (2S)-2-amino-3,3-bis[4-(trifluoromethyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 25107037 |
| Molecular Formula | C17H13F6NO2 |
| Molecular Weight | 377.28 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | (2S)-2-amino-3,3-bis[4-(trifluoromethyl)phenyl]propanoic acid |
| SMILES | N[C@H](C(=O)O)C(c1ccc(C(F)(F)F)cc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H13F6NO2/c18-16(19,20)11-5-1-9(2-6-11)13(14(24)15(25)26)10-3-7-12(8-4-10)17(21,22)23/h1-8,13-14H,24H2,(H,25,26)/t14-/m0/s1 |
| InChIKey | FVLOLAVAYZINCW-AWEZNQCLSA-N |
| XLogP | 4.27 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.28 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |