C14H17F3N2O4 — CID 170872841
3,5-diamino-4-[4-(trifluoromethyl)phenyl]heptanedioic acid (PubChem CID 170872841) has the molecular formula C14H17F3N2O4 and a molecular weight of 334.29 g/mol. Its IUPAC name is 3,5-diamino-4-[4-(trifluoromethyl)phenyl]heptanedioic acid.
| Compound Name | 3,5-diamino-4-[4-(trifluoromethyl)phenyl]heptanedioic acid |
|---|---|
| PubChem CID | 170872841 |
| Molecular Formula | C14H17F3N2O4 |
| Molecular Weight | 334.29 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 3,5-diamino-4-[4-(trifluoromethyl)phenyl]heptanedioic acid |
| SMILES | NC(CC(=O)O)C(c1ccc(C(F)(F)F)cc1)C(N)CC(=O)O |
| InChI | InChI=1S/C14H17F3N2O4/c15-14(16,17)8-3-1-7(2-4-8)13(9(18)5-11(20)21)10(19)6-12(22)23/h1-4,9-10,13H,5-6,18-19H2,(H,20,21)(H,22,23) |
| InChIKey | DVJOOOIHHRGETB-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.29 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |