3,5-diamino-4-[4-(trifluoromethyl)phenyl]heptanedioic acid

C14H17F3N2O4 — CID 170872841

IUPAC3,5-diamino-4-[4-(trifluoromethyl)phenyl]heptanedioic acid
SMILESNC(CC(=O)O)C(c1ccc(C(F)(F)F)cc1)C(N)CC(=O)O
InChIInChI=1S/C14H17F3N2O4/c15-14(16,17)8-3-1-7(2-4-8)13(9(18)5-11(20)21)10(19)6-12(22)23/h1-4,9-10,13H,5-6,18-19H2,(H,20,21)(H,22,23)
InChIKeyDVJOOOIHHRGETB-UHFFFAOYSA-N
MW334.29 g/mol
LogP1.39
Rot. Bonds7

About 3,5-diamino-4-[4-(trifluoromethyl)phenyl]heptanedioic acid

3,5-diamino-4-[4-(trifluoromethyl)phenyl]heptanedioic acid (PubChem CID 170872841) has the molecular formula C14H17F3N2O4 and a molecular weight of 334.29 g/mol. Its IUPAC name is 3,5-diamino-4-[4-(trifluoromethyl)phenyl]heptanedioic acid.

Molecular Properties

Compound Name3,5-diamino-4-[4-(trifluoromethyl)phenyl]heptanedioic acid
PubChem CID170872841
Molecular FormulaC14H17F3N2O4
Molecular Weight334.29 g/mol
Exact Mass334.11
IUPAC Name3,5-diamino-4-[4-(trifluoromethyl)phenyl]heptanedioic acid
SMILESNC(CC(=O)O)C(c1ccc(C(F)(F)F)cc1)C(N)CC(=O)O
InChIInChI=1S/C14H17F3N2O4/c15-14(16,17)8-3-1-7(2-4-8)13(9(18)5-11(20)21)10(19)6-12(22)23/h1-4,9-10,13H,5-6,18-19H2,(H,20,21)(H,22,23)
InChIKeyDVJOOOIHHRGETB-UHFFFAOYSA-N
XLogP1.39
TPSA126.64 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500334.29
LogP ≤ 51.39
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Analyze 3,5-diamino-4-[4-(trifluoromethyl)phenyl]heptanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,5-diamino-4-[4-(trifluoromethyl)phenyl]heptanedioic acid?
The IUPAC name of 3,5-diamino-4-[4-(trifluoromethyl)phenyl]heptanedioic acid (CID 170872841) is 3,5-diamino-4-[4-(trifluoromethyl)phenyl]heptanedioic acid.
What is the SMILES notation for 3,5-diamino-4-[4-(trifluoromethyl)phenyl]heptanedioic acid?
The canonical SMILES for 3,5-diamino-4-[4-(trifluoromethyl)phenyl]heptanedioic acid is NC(CC(=O)O)C(c1ccc(C(F)(F)F)cc1)C(N)CC(=O)O.
What is the InChIKey of 3,5-diamino-4-[4-(trifluoromethyl)phenyl]heptanedioic acid?
The InChIKey is DVJOOOIHHRGETB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17F3N2O4/c15-14(16,17)8-3-1-7(2-4-8)13(9(18)5-11(20)21)10(19)6-12(22)23/h1-4,9-10,13H,5-6,18-19H2,(H,20,21)(H,22,23).
What are the key properties of 3,5-diamino-4-[4-(trifluoromethyl)phenyl]heptanedioic acid?
3,5-diamino-4-[4-(trifluoromethyl)phenyl]heptanedioic acid has a molecular weight of 334.29 g/mol, XLogP of 1.39, 7 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-diamino-4-[4-(trifluoromethyl)phenyl]heptanedioic acid is sourced from PubChem (CID 170872841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).