C12H11F3O4 — CID 18948511
2-[[4-(trifluoromethyl)phenyl]methyl]butanedioic acid (PubChem CID 18948511) has the molecular formula C12H11F3O4 and a molecular weight of 276.21 g/mol. Its IUPAC name is 2-[[4-(trifluoromethyl)phenyl]methyl]butanedioic acid.
| Compound Name | 2-[[4-(trifluoromethyl)phenyl]methyl]butanedioic acid |
|---|---|
| PubChem CID | 18948511 |
| Molecular Formula | C12H11F3O4 |
| Molecular Weight | 276.21 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | 2-[[4-(trifluoromethyl)phenyl]methyl]butanedioic acid |
| SMILES | O=C(O)CC(Cc1ccc(C(F)(F)F)cc1)C(=O)O |
| InChI | InChI=1S/C12H11F3O4/c13-12(14,15)9-3-1-7(2-4-9)5-8(11(18)19)6-10(16)17/h1-4,8H,5-6H2,(H,16,17)(H,18,19) |
| InChIKey | OFYADYZNMDKXIW-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.21 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |