C12H10ClF3O5 — CID 68674816
(2S)-2-[[3-chloro-4-hydroxy-5-(trifluoromethyl)phenyl]methyl]butanedioic acid (PubChem CID 68674816) has the molecular formula C12H10ClF3O5 and a molecular weight of 326.65 g/mol. Its IUPAC name is (2S)-2-[[3-chloro-4-hydroxy-5-(trifluoromethyl)phenyl]methyl]butanedioic acid.
| Compound Name | (2S)-2-[[3-chloro-4-hydroxy-5-(trifluoromethyl)phenyl]methyl]butanedioic acid |
|---|---|
| PubChem CID | 68674816 |
| Molecular Formula | C12H10ClF3O5 |
| Molecular Weight | 326.65 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | (2S)-2-[[3-chloro-4-hydroxy-5-(trifluoromethyl)phenyl]methyl]butanedioic acid |
| SMILES | O=C(O)CC(Cc1cc(Cl)c(O)c(C(F)(F)F)c1)C(=O)O |
| InChI | InChI=1S/C12H10ClF3O5/c13-8-3-5(1-6(11(20)21)4-9(17)18)2-7(10(8)19)12(14,15)16/h2-3,6,19H,1,4H2,(H,17,18)(H,20,21) |
| InChIKey | KVGAUNYCIURXTH-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.65 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |