C12H10ClF3O4 — CID 142773342
2-[[4-chloro-3-(trifluoromethyl)phenyl]methyl]butanedioic acid (PubChem CID 142773342) has the molecular formula C12H10ClF3O4 and a molecular weight of 310.66 g/mol. Its IUPAC name is 2-[[4-chloro-3-(trifluoromethyl)phenyl]methyl]butanedioic acid.
| Compound Name | 2-[[4-chloro-3-(trifluoromethyl)phenyl]methyl]butanedioic acid |
|---|---|
| PubChem CID | 142773342 |
| Molecular Formula | C12H10ClF3O4 |
| Molecular Weight | 310.66 g/mol |
| Exact Mass | 310.02 |
| IUPAC Name | 2-[[4-chloro-3-(trifluoromethyl)phenyl]methyl]butanedioic acid |
| SMILES | O=C(O)CC(Cc1ccc(Cl)c(C(F)(F)F)c1)C(=O)O |
| InChI | InChI=1S/C12H10ClF3O4/c13-9-2-1-6(4-8(9)12(14,15)16)3-7(11(19)20)5-10(17)18/h1-2,4,7H,3,5H2,(H,17,18)(H,19,20) |
| InChIKey | BBJQGGDYPVRHSO-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.66 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |